C10H16O2 — CID 12838693
1-(2-ethyl-2,5-dimethyl-3H-furan-4-yl)ethanone (PubChem CID 12838693) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-(2-ethyl-2,5-dimethyl-3H-furan-4-yl)ethanone.
| Compound Name | 1-(2-ethyl-2,5-dimethyl-3H-furan-4-yl)ethanone |
|---|---|
| PubChem CID | 12838693 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 1-(2-ethyl-2,5-dimethyl-3H-furan-4-yl)ethanone |
| SMILES | CCC1(C)CC(C(C)=O)=C(C)O1 |
| InChI | InChI=1S/C10H16O2/c1-5-10(4)6-9(7(2)11)8(3)12-10/h5-6H2,1-4H3 |
| InChIKey | JVVABNRNINSNOU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |