About 1,3-benzodioxole-4,7-dione
1,3-benzodioxole-4,7-dione (PubChem CID 12838779) has the molecular formula C7H4O4
and a molecular weight of 152.11 g/mol. Its IUPAC name is 1,3-benzodioxole-4,7-dione.
Molecular Properties
| Compound Name | 1,3-benzodioxole-4,7-dione |
| PubChem CID | 12838779 |
| Molecular Formula | C7H4O4 |
| Molecular Weight | 152.11 g/mol |
| Exact Mass | 152.01 |
| IUPAC Name | 1,3-benzodioxole-4,7-dione |
| SMILES | O=C1C=CC(=O)C2=C1OCO2 |
| InChI | InChI=1S/C7H4O4/c8-4-1-2-5(9)7-6(4)10-3-11-7/h1-2H,3H2 |
| InChIKey | GPUOEYYRNOTMES-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.11 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze 1,3-benzodioxole-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzodioxole-4,7-dione?
The IUPAC name of 1,3-benzodioxole-4,7-dione (CID 12838779) is 1,3-benzodioxole-4,7-dione.
What is the SMILES notation for 1,3-benzodioxole-4,7-dione?
The canonical SMILES for 1,3-benzodioxole-4,7-dione is O=C1C=CC(=O)C2=C1OCO2.
What is the InChIKey of 1,3-benzodioxole-4,7-dione?
The InChIKey is GPUOEYYRNOTMES-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4O4/c8-4-1-2-5(9)7-6(4)10-3-11-7/h1-2H,3H2.
What are the key properties of 1,3-benzodioxole-4,7-dione?
1,3-benzodioxole-4,7-dione has a molecular weight of 152.11 g/mol, XLogP of -0.09, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzodioxole-4,7-dione is sourced from PubChem (CID 12838779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).