C24H50N2O5 — CID 12838862
N-[[9-[(hexylamino)methyl]-1,4,7,10,13-pentaoxacyclopentadec-2-yl]methyl]hexan-1-amine (PubChem CID 12838862) has the molecular formula C24H50N2O5 and a molecular weight of 446.67 g/mol. Its IUPAC name is N-[[9-[(hexylamino)methyl]-1,4,7,10,13-pentaoxacyclopentadec-2-yl]methyl]hexan-1-amine.
| Compound Name | N-[[9-[(hexylamino)methyl]-1,4,7,10,13-pentaoxacyclopentadec-2-yl]methyl]hexan-1-amine |
|---|---|
| PubChem CID | 12838862 |
| Molecular Formula | C24H50N2O5 |
| Molecular Weight | 446.67 g/mol |
| Exact Mass | 446.37 |
| IUPAC Name | N-[[9-[(hexylamino)methyl]-1,4,7,10,13-pentaoxacyclopentadec-2-yl]methyl]hexan-1-amine |
| SMILES | CCCCCCNCC1COCCOCC(CNCCCCCC)OCCOCCO1 |
| InChI | InChI=1S/C24H50N2O5/c1-3-5-7-9-11-25-19-23-21-28-13-14-29-22-24(20-26-12-10-8-6-4-2)31-18-16-27-15-17-30-23/h23-26H,3-22H2,1-2H3 |
| InChIKey | DSMAOVDVEZIILW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 70.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.67 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|