About 2-ethynyl-1-methylindole
2-ethynyl-1-methylindole (PubChem CID 12839097) has the molecular formula C11H9N
and a molecular weight of 155.20 g/mol. Its IUPAC name is 2-ethynyl-1-methylindole.
Molecular Properties
| Compound Name | 2-ethynyl-1-methylindole |
| PubChem CID | 12839097 |
| Molecular Formula | C11H9N |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 2-ethynyl-1-methylindole |
| SMILES | C#Cc1cc2ccccc2n1C |
| InChI | InChI=1S/C11H9N/c1-3-10-8-9-6-4-5-7-11(9)12(10)2/h1,4-8H,2H3 |
| InChIKey | KKFMTTIGOXDYOP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethynyl-1-methylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethynyl-1-methylindole?
The IUPAC name of 2-ethynyl-1-methylindole (CID 12839097) is 2-ethynyl-1-methylindole.
What is the SMILES notation for 2-ethynyl-1-methylindole?
The canonical SMILES for 2-ethynyl-1-methylindole is C#Cc1cc2ccccc2n1C.
What is the InChIKey of 2-ethynyl-1-methylindole?
The InChIKey is KKFMTTIGOXDYOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N/c1-3-10-8-9-6-4-5-7-11(9)12(10)2/h1,4-8H,2H3.
What are the key properties of 2-ethynyl-1-methylindole?
2-ethynyl-1-methylindole has a molecular weight of 155.20 g/mol, XLogP of 2.16, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethynyl-1-methylindole is sourced from PubChem (CID 12839097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).