About ethyl 3-(2-oxo-1,3-thiazol-3-yl)propanoate
ethyl 3-(2-oxo-1,3-thiazol-3-yl)propanoate (PubChem CID 12839817) has the molecular formula C8H11NO3S
and a molecular weight of 201.25 g/mol. Its IUPAC name is ethyl 3-(2-oxo-1,3-thiazol-3-yl)propanoate.
Molecular Properties
| Compound Name | ethyl 3-(2-oxo-1,3-thiazol-3-yl)propanoate |
| PubChem CID | 12839817 |
| Molecular Formula | C8H11NO3S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | ethyl 3-(2-oxo-1,3-thiazol-3-yl)propanoate |
| SMILES | CCOC(=O)CCn1ccsc1=O |
| InChI | InChI=1S/C8H11NO3S/c1-2-12-7(10)3-4-9-5-6-13-8(9)11/h5-6H,2-4H2,1H3 |
| InChIKey | ICELGAJEVVTCCF-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-(2-oxo-1,3-thiazol-3-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(2-oxo-1,3-thiazol-3-yl)propanoate?
The IUPAC name of ethyl 3-(2-oxo-1,3-thiazol-3-yl)propanoate (CID 12839817) is ethyl 3-(2-oxo-1,3-thiazol-3-yl)propanoate.
What is the SMILES notation for ethyl 3-(2-oxo-1,3-thiazol-3-yl)propanoate?
The canonical SMILES for ethyl 3-(2-oxo-1,3-thiazol-3-yl)propanoate is CCOC(=O)CCn1ccsc1=O.
What is the InChIKey of ethyl 3-(2-oxo-1,3-thiazol-3-yl)propanoate?
The InChIKey is ICELGAJEVVTCCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3S/c1-2-12-7(10)3-4-9-5-6-13-8(9)11/h5-6H,2-4H2,1H3.
What are the key properties of ethyl 3-(2-oxo-1,3-thiazol-3-yl)propanoate?
ethyl 3-(2-oxo-1,3-thiazol-3-yl)propanoate has a molecular weight of 201.25 g/mol, XLogP of 0.86, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(2-oxo-1,3-thiazol-3-yl)propanoate is sourced from PubChem (CID 12839817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).