About 1-cyclopenta-1,4-dien-1-yl-N,N-dimethylethanamine
1-cyclopenta-1,4-dien-1-yl-N,N-dimethylethanamine (PubChem CID 12839842) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is 1-cyclopenta-1,4-dien-1-yl-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 1-cyclopenta-1,4-dien-1-yl-N,N-dimethylethanamine |
| PubChem CID | 12839842 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 1-cyclopenta-1,4-dien-1-yl-N,N-dimethylethanamine |
| SMILES | CC(C1=CCC=C1)N(C)C |
| InChI | InChI=1S/C9H15N/c1-8(10(2)3)9-6-4-5-7-9/h4,6-8H,5H2,1-3H3 |
| InChIKey | HBKNCCCVCDKILO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopenta-1,4-dien-1-yl-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-1,4-dien-1-yl-N,N-dimethylethanamine?
The IUPAC name of 1-cyclopenta-1,4-dien-1-yl-N,N-dimethylethanamine (CID 12839842) is 1-cyclopenta-1,4-dien-1-yl-N,N-dimethylethanamine.
What is the SMILES notation for 1-cyclopenta-1,4-dien-1-yl-N,N-dimethylethanamine?
The canonical SMILES for 1-cyclopenta-1,4-dien-1-yl-N,N-dimethylethanamine is CC(C1=CCC=C1)N(C)C.
What is the InChIKey of 1-cyclopenta-1,4-dien-1-yl-N,N-dimethylethanamine?
The InChIKey is HBKNCCCVCDKILO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N/c1-8(10(2)3)9-6-4-5-7-9/h4,6-8H,5H2,1-3H3.
What are the key properties of 1-cyclopenta-1,4-dien-1-yl-N,N-dimethylethanamine?
1-cyclopenta-1,4-dien-1-yl-N,N-dimethylethanamine has a molecular weight of 137.23 g/mol, XLogP of 1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-1,4-dien-1-yl-N,N-dimethylethanamine is sourced from PubChem (CID 12839842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).