C21H17Cl2FN2O3S — CID 1284016
2-[(2-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-(4-fluorophenyl)acetamide (PubChem CID 1284016) has the molecular formula C21H17Cl2FN2O3S and a molecular weight of 467.35 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 1284016 |
| Molecular Formula | C21H17Cl2FN2O3S |
| Molecular Weight | 467.35 g/mol |
| Exact Mass | 466.03 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(CN(Cc1ccccc1Cl)S(=O)(=O)c1ccc(Cl)cc1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C21H17Cl2FN2O3S/c22-16-5-11-19(12-6-16)30(28,29)26(13-15-3-1-2-4-20(15)23)14-21(27)25-18-9-7-17(24)8-10-18/h1-12H,13-14H2,(H,25,27) |
| InChIKey | VMDCDJCIUOCPQH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.35 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |