C30H20N4O2 — CID 12840844
1,4-bis(4-methylanilino)-9,10-dioxoanthracene-2,3-dicarbonitrile (PubChem CID 12840844) has the molecular formula C30H20N4O2 and a molecular weight of 468.52 g/mol. Its IUPAC name is 1,4-bis(4-methylanilino)-9,10-dioxoanthracene-2,3-dicarbonitrile.
| Compound Name | 1,4-bis(4-methylanilino)-9,10-dioxoanthracene-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 12840844 |
| Molecular Formula | C30H20N4O2 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 1,4-bis(4-methylanilino)-9,10-dioxoanthracene-2,3-dicarbonitrile |
| SMILES | Cc1ccc(Nc2c(C#N)c(C#N)c(Nc3ccc(C)cc3)c3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C30H20N4O2/c1-17-7-11-19(12-8-17)33-27-23(15-31)24(16-32)28(34-20-13-9-18(2)10-14-20)26-25(27)29(35)21-5-3-4-6-22(21)30(26)36/h3-14,33-34H,1-2H3 |
| InChIKey | SMDOWFLEZPUWRB-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|