C12H16N2 — CID 12841383
1-methyl-2,3,3a,4,5,9b-hexahydropyrrolo[2,3-f]quinoline (PubChem CID 12841383) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-methyl-2,3,3a,4,5,9b-hexahydropyrrolo[2,3-f]quinoline.
| Compound Name | 1-methyl-2,3,3a,4,5,9b-hexahydropyrrolo[2,3-f]quinoline |
|---|---|
| PubChem CID | 12841383 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1-methyl-2,3,3a,4,5,9b-hexahydropyrrolo[2,3-f]quinoline |
| SMILES | CN1CCC2CCc3ncccc3C21 |
| InChI | InChI=1S/C12H16N2/c1-14-8-6-9-4-5-11-10(12(9)14)3-2-7-13-11/h2-3,7,9,12H,4-6,8H2,1H3 |
| InChIKey | IWIBAQWOZHPVCE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |