C23H20N4S — CID 1284142
(3S)-N-(1,10-phenanthrolin-5-yl)-3-phenylpyrrolidine-1-carbothioamide (PubChem CID 1284142) has the molecular formula C23H20N4S and a molecular weight of 384.51 g/mol. Its IUPAC name is (3S)-N-(1,10-phenanthrolin-5-yl)-3-phenylpyrrolidine-1-carbothioamide.
| Compound Name | (3S)-N-(1,10-phenanthrolin-5-yl)-3-phenylpyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 1284142 |
| Molecular Formula | C23H20N4S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | (3S)-N-(1,10-phenanthrolin-5-yl)-3-phenylpyrrolidine-1-carbothioamide |
| SMILES | S=C(Nc1cc2cccnc2c2ncccc12)N1CC[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C23H20N4S/c28-23(27-13-10-18(15-27)16-6-2-1-3-7-16)26-20-14-17-8-4-11-24-21(17)22-19(20)9-5-12-25-22/h1-9,11-12,14,18H,10,13,15H2,(H,26,28)/t18-/m1/s1 |
| InChIKey | HNZKLXNNOJHFMX-GOSISDBHSA-N |
| XLogP | 4.97 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|