About 6-chloro-3-methyl-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride
6-chloro-3-methyl-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride (PubChem CID 12841580) has the molecular formula C11H16Cl3N5
and a molecular weight of 324.64 g/mol. Its IUPAC name is 6-chloro-3-methyl-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride.
Molecular Properties
| Compound Name | 6-chloro-3-methyl-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride |
| PubChem CID | 12841580 |
| Molecular Formula | C11H16Cl3N5 |
| Molecular Weight | 324.64 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 6-chloro-3-methyl-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride |
| SMILES | Cc1cnc2c(N3CCNCC3)nc(Cl)cn12.Cl.Cl |
| InChI | InChI=1S/C11H14ClN5.2ClH/c1-8-6-14-10-11(15-9(12)7-17(8)10)16-4-2-13-3-5-16;;/h6-7,13H,2-5H2,1H3;2*1H |
| InChIKey | MPSATKXZENVNBK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.64 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-3-methyl-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-methyl-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride?
The IUPAC name of 6-chloro-3-methyl-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride (CID 12841580) is 6-chloro-3-methyl-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride.
What is the SMILES notation for 6-chloro-3-methyl-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride?
The canonical SMILES for 6-chloro-3-methyl-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride is Cc1cnc2c(N3CCNCC3)nc(Cl)cn12.Cl.Cl.
What is the InChIKey of 6-chloro-3-methyl-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride?
The InChIKey is MPSATKXZENVNBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClN5.2ClH/c1-8-6-14-10-11(15-9(12)7-17(8)10)16-4-2-13-3-5-16;;/h6-7,13H,2-5H2,1H3;2*1H.
What are the key properties of 6-chloro-3-methyl-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride?
6-chloro-3-methyl-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride has a molecular weight of 324.64 g/mol, XLogP of 1.94, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-methyl-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride is sourced from PubChem (CID 12841580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).