About 6-chloro-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride
6-chloro-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride (PubChem CID 12841597) has the molecular formula C10H14Cl3N5
and a molecular weight of 310.62 g/mol. Its IUPAC name is 6-chloro-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride.
Molecular Properties
| Compound Name | 6-chloro-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride |
| PubChem CID | 12841597 |
| Molecular Formula | C10H14Cl3N5 |
| Molecular Weight | 310.62 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 6-chloro-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride |
| SMILES | Cl.Cl.Clc1cn2ccnc2c(N2CCNCC2)n1 |
| InChI | InChI=1S/C10H12ClN5.2ClH/c11-8-7-16-6-3-13-9(16)10(14-8)15-4-1-12-2-5-15;;/h3,6-7,12H,1-2,4-5H2;2*1H |
| InChIKey | ZAWBLLPFYFRFJG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.62 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride?
The IUPAC name of 6-chloro-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride (CID 12841597) is 6-chloro-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride.
What is the SMILES notation for 6-chloro-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride?
The canonical SMILES for 6-chloro-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride is Cl.Cl.Clc1cn2ccnc2c(N2CCNCC2)n1.
What is the InChIKey of 6-chloro-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride?
The InChIKey is ZAWBLLPFYFRFJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClN5.2ClH/c11-8-7-16-6-3-13-9(16)10(14-8)15-4-1-12-2-5-15;;/h3,6-7,12H,1-2,4-5H2;2*1H.
What are the key properties of 6-chloro-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride?
6-chloro-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride has a molecular weight of 310.62 g/mol, XLogP of 1.64, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-8-piperazin-1-ylimidazo[1,2-a]pyrazine;dihydrochloride is sourced from PubChem (CID 12841597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).