About 3-phenoxyphenol
3-phenoxyphenol (PubChem CID 12842) has the molecular formula C12H10O2
and a molecular weight of 186.21 g/mol. Its IUPAC name is 3-phenoxyphenol.
Molecular Properties
| Compound Name | 3-phenoxyphenol |
| PubChem CID | 12842 |
| Molecular Formula | C12H10O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 3-phenoxyphenol |
| SMILES | Oc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C12H10O2/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9,13H |
| InChIKey | HBUCPZGYBSEEHF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenoxyphenol?
The IUPAC name of 3-phenoxyphenol (CID 12842) is 3-phenoxyphenol.
What is the SMILES notation for 3-phenoxyphenol?
The canonical SMILES for 3-phenoxyphenol is Oc1cccc(Oc2ccccc2)c1.
What is the InChIKey of 3-phenoxyphenol?
The InChIKey is HBUCPZGYBSEEHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9,13H.
What are the key properties of 3-phenoxyphenol?
3-phenoxyphenol has a molecular weight of 186.21 g/mol, XLogP of 3.18, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenoxyphenol is sourced from PubChem (CID 12842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).