About 7-(benzenesulfonyl)-1,4-dioxaspiro[4.5]decane
7-(benzenesulfonyl)-1,4-dioxaspiro[4.5]decane (PubChem CID 12842291) has the molecular formula C14H18O4S
and a molecular weight of 282.36 g/mol. Its IUPAC name is 7-(benzenesulfonyl)-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 7-(benzenesulfonyl)-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 12842291 |
| Molecular Formula | C14H18O4S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 7-(benzenesulfonyl)-1,4-dioxaspiro[4.5]decane |
| SMILES | O=S(=O)(c1ccccc1)C1CCCC2(C1)OCCO2 |
| InChI | InChI=1S/C14H18O4S/c15-19(16,12-5-2-1-3-6-12)13-7-4-8-14(11-13)17-9-10-18-14/h1-3,5-6,13H,4,7-11H2 |
| InChIKey | KZRWSVHOYCUWNM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(benzenesulfonyl)-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(benzenesulfonyl)-1,4-dioxaspiro[4.5]decane?
The IUPAC name of 7-(benzenesulfonyl)-1,4-dioxaspiro[4.5]decane (CID 12842291) is 7-(benzenesulfonyl)-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for 7-(benzenesulfonyl)-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for 7-(benzenesulfonyl)-1,4-dioxaspiro[4.5]decane is O=S(=O)(c1ccccc1)C1CCCC2(C1)OCCO2.
What is the InChIKey of 7-(benzenesulfonyl)-1,4-dioxaspiro[4.5]decane?
The InChIKey is KZRWSVHOYCUWNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O4S/c15-19(16,12-5-2-1-3-6-12)13-7-4-8-14(11-13)17-9-10-18-14/h1-3,5-6,13H,4,7-11H2.
What are the key properties of 7-(benzenesulfonyl)-1,4-dioxaspiro[4.5]decane?
7-(benzenesulfonyl)-1,4-dioxaspiro[4.5]decane has a molecular weight of 282.36 g/mol, XLogP of 2.15, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(benzenesulfonyl)-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 12842291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).