About triphenylsilylmethanol
triphenylsilylmethanol (PubChem CID 12842304) has the molecular formula C19H18OSi
and a molecular weight of 290.44 g/mol. Its IUPAC name is triphenylsilylmethanol.
Molecular Properties
| Compound Name | triphenylsilylmethanol |
| PubChem CID | 12842304 |
| Molecular Formula | C19H18OSi |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | triphenylsilylmethanol |
| SMILES | OC[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H18OSi/c20-16-21(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,20H,16H2 |
| InChIKey | RZBLAGLYKKRZNL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze triphenylsilylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenylsilylmethanol?
The IUPAC name of triphenylsilylmethanol (CID 12842304) is triphenylsilylmethanol.
What is the SMILES notation for triphenylsilylmethanol?
The canonical SMILES for triphenylsilylmethanol is OC[Si](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of triphenylsilylmethanol?
The InChIKey is RZBLAGLYKKRZNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18OSi/c20-16-21(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,20H,16H2.
What are the key properties of triphenylsilylmethanol?
triphenylsilylmethanol has a molecular weight of 290.44 g/mol, XLogP of 1.69, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triphenylsilylmethanol is sourced from PubChem (CID 12842304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).