C6F10 — CID 12842338
1,3,3,4,4-pentafluoro-2-(1,1,2,2,2-pentafluoroethyl)cyclobutene (PubChem CID 12842338) has the molecular formula C6F10 and a molecular weight of 262.05 g/mol. Its IUPAC name is 1,3,3,4,4-pentafluoro-2-(1,1,2,2,2-pentafluoroethyl)cyclobutene.
| Compound Name | 1,3,3,4,4-pentafluoro-2-(1,1,2,2,2-pentafluoroethyl)cyclobutene |
|---|---|
| PubChem CID | 12842338 |
| Molecular Formula | C6F10 |
| Molecular Weight | 262.05 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | 1,3,3,4,4-pentafluoro-2-(1,1,2,2,2-pentafluoroethyl)cyclobutene |
| SMILES | FC1=C(C(F)(F)C(F)(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C6F10/c7-2-1(3(8,9)5(2,12)13)4(10,11)6(14,15)16 |
| InChIKey | NXHQVQZLTRXACX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.05 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|