C9H13NO2 — CID 12842415
2-methyl-4,5,6,7-tetrahydroisoindole-1,3-diol (PubChem CID 12842415) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-methyl-4,5,6,7-tetrahydroisoindole-1,3-diol.
| Compound Name | 2-methyl-4,5,6,7-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 12842415 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 2-methyl-4,5,6,7-tetrahydroisoindole-1,3-diol |
| SMILES | Cn1c(O)c2c(c1O)CCCC2 |
| InChI | InChI=1S/C9H13NO2/c1-10-8(11)6-4-2-3-5-7(6)9(10)12/h11-12H,2-5H2,1H3 |
| InChIKey | PRKFLSBKHLTZRL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |