C24H32ClNO3 — CID 12843137
4-[ethyl-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]butyl benzoate;hydrochloride (PubChem CID 12843137) has the molecular formula C24H32ClNO3 and a molecular weight of 417.98 g/mol. Its IUPAC name is 4-[ethyl-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]butyl benzoate;hydrochloride.
| Compound Name | 4-[ethyl-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]butyl benzoate;hydrochloride |
|---|---|
| PubChem CID | 12843137 |
| Molecular Formula | C24H32ClNO3 |
| Molecular Weight | 417.98 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 4-[ethyl-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]butyl benzoate;hydrochloride |
| SMILES | CCN(CCCCOC(=O)c1ccccc1)C1CCc2cc(OC)ccc2C1.Cl |
| InChI | InChI=1S/C24H31NO3.ClH/c1-3-25(15-7-8-16-28-24(26)19-9-5-4-6-10-19)22-13-11-21-18-23(27-2)14-12-20(21)17-22;/h4-6,9-10,12,14,18,22H,3,7-8,11,13,15-17H2,1-2H3;1H |
| InChIKey | AGCVZEKYBCJMRZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.98 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|