C25H34ClNO4 — CID 12843142
4-[ethyl-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]butyl 4-methoxybenzoate;hydrochloride (PubChem CID 12843142) has the molecular formula C25H34ClNO4 and a molecular weight of 448.00 g/mol. Its IUPAC name is 4-[ethyl-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]butyl 4-methoxybenzoate;hydrochloride.
| Compound Name | 4-[ethyl-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]butyl 4-methoxybenzoate;hydrochloride |
|---|---|
| PubChem CID | 12843142 |
| Molecular Formula | C25H34ClNO4 |
| Molecular Weight | 448.00 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 4-[ethyl-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]butyl 4-methoxybenzoate;hydrochloride |
| SMILES | CCN(CCCCOC(=O)c1ccc(OC)cc1)C1CCc2cc(OC)ccc2C1.Cl |
| InChI | InChI=1S/C25H33NO4.ClH/c1-4-26(22-11-7-21-18-24(29-3)14-10-20(21)17-22)15-5-6-16-30-25(27)19-8-12-23(28-2)13-9-19;/h8-10,12-14,18,22H,4-7,11,15-17H2,1-3H3;1H |
| InChIKey | JXOJGMMQQDMQHN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.00 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|