About 6-heptyloxan-2-one
6-heptyloxan-2-one (PubChem CID 12844) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is 6-heptyloxan-2-one.
Molecular Properties
| Compound Name | 6-heptyloxan-2-one |
| PubChem CID | 12844 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 6-heptyloxan-2-one |
| SMILES | CCCCCCCC1CCCC(=O)O1 |
| InChI | InChI=1S/C12H22O2/c1-2-3-4-5-6-8-11-9-7-10-12(13)14-11/h11H,2-10H2,1H3 |
| InChIKey | QRPLZGZHJABGRS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-heptyloxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-heptyloxan-2-one?
The IUPAC name of 6-heptyloxan-2-one (CID 12844) is 6-heptyloxan-2-one.
What is the SMILES notation for 6-heptyloxan-2-one?
The canonical SMILES for 6-heptyloxan-2-one is CCCCCCCC1CCCC(=O)O1.
What is the InChIKey of 6-heptyloxan-2-one?
The InChIKey is QRPLZGZHJABGRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2/c1-2-3-4-5-6-8-11-9-7-10-12(13)14-11/h11H,2-10H2,1H3.
What are the key properties of 6-heptyloxan-2-one?
6-heptyloxan-2-one has a molecular weight of 198.31 g/mol, XLogP of 3.44, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-heptyloxan-2-one is sourced from PubChem (CID 12844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).