About 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetic acid
2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetic acid (PubChem CID 12844136) has the molecular formula C6H5FN2O4
and a molecular weight of 188.11 g/mol. Its IUPAC name is 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetic acid |
| PubChem CID | 12844136 |
| Molecular Formula | C6H5FN2O4 |
| Molecular Weight | 188.11 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetic acid |
| SMILES | O=C(O)Cn1c(=O)[nH]cc(F)c1=O |
| InChI | InChI=1S/C6H5FN2O4/c7-3-1-8-6(13)9(5(3)12)2-4(10)11/h1H,2H2,(H,8,13)(H,10,11) |
| InChIKey | NWNLKDUEVSBIKS-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.11 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetic acid?
The IUPAC name of 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetic acid (CID 12844136) is 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetic acid.
What is the SMILES notation for 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetic acid?
The canonical SMILES for 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetic acid is O=C(O)Cn1c(=O)[nH]cc(F)c1=O.
What is the InChIKey of 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetic acid?
The InChIKey is NWNLKDUEVSBIKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5FN2O4/c7-3-1-8-6(13)9(5(3)12)2-4(10)11/h1H,2H2,(H,8,13)(H,10,11).
What are the key properties of 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetic acid?
2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetic acid has a molecular weight of 188.11 g/mol, XLogP of -1.24, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)acetic acid is sourced from PubChem (CID 12844136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).