C9H15NO3S2 — CID 12844440
S-butyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)carbamothioate (PubChem CID 12844440) has the molecular formula C9H15NO3S2 and a molecular weight of 249.36 g/mol. Its IUPAC name is S-butyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)carbamothioate.
| Compound Name | S-butyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)carbamothioate |
|---|---|
| PubChem CID | 12844440 |
| Molecular Formula | C9H15NO3S2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | S-butyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)carbamothioate |
| SMILES | CCCCSC(=O)NC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C9H15NO3S2/c1-2-3-5-14-9(11)10-8-4-6-15(12,13)7-8/h4,6,8H,2-3,5,7H2,1H3,(H,10,11) |
| InChIKey | NYZAVNWYGASYHW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|