About 5,6-dimethoxy-2,3,3-trimethylindole
5,6-dimethoxy-2,3,3-trimethylindole (PubChem CID 12844901) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is 5,6-dimethoxy-2,3,3-trimethylindole.
Molecular Properties
| Compound Name | 5,6-dimethoxy-2,3,3-trimethylindole |
| PubChem CID | 12844901 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 5,6-dimethoxy-2,3,3-trimethylindole |
| SMILES | COc1cc2c(cc1OC)C(C)(C)C(C)=N2 |
| InChI | InChI=1S/C13H17NO2/c1-8-13(2,3)9-6-11(15-4)12(16-5)7-10(9)14-8/h6-7H,1-5H3 |
| InChIKey | QJVLAHGVELEJFG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,6-dimethoxy-2,3,3-trimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethoxy-2,3,3-trimethylindole?
The IUPAC name of 5,6-dimethoxy-2,3,3-trimethylindole (CID 12844901) is 5,6-dimethoxy-2,3,3-trimethylindole.
What is the SMILES notation for 5,6-dimethoxy-2,3,3-trimethylindole?
The canonical SMILES for 5,6-dimethoxy-2,3,3-trimethylindole is COc1cc2c(cc1OC)C(C)(C)C(C)=N2.
What is the InChIKey of 5,6-dimethoxy-2,3,3-trimethylindole?
The InChIKey is QJVLAHGVELEJFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2/c1-8-13(2,3)9-6-11(15-4)12(16-5)7-10(9)14-8/h6-7H,1-5H3.
What are the key properties of 5,6-dimethoxy-2,3,3-trimethylindole?
5,6-dimethoxy-2,3,3-trimethylindole has a molecular weight of 219.28 g/mol, XLogP of 3.09, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethoxy-2,3,3-trimethylindole is sourced from PubChem (CID 12844901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).