C16H19ClN4OS — CID 1284554
2-chloro-N-[5-(2-piperidin-1-ylethyl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 1284554) has the molecular formula C16H19ClN4OS and a molecular weight of 350.88 g/mol. Its IUPAC name is 2-chloro-N-[5-(2-piperidin-1-ylethyl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2-chloro-N-[5-(2-piperidin-1-ylethyl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 1284554 |
| Molecular Formula | C16H19ClN4OS |
| Molecular Weight | 350.88 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2-chloro-N-[5-(2-piperidin-1-ylethyl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nnc(CCN2CCCCC2)s1)c1ccccc1Cl |
| InChI | InChI=1S/C16H19ClN4OS/c17-13-7-3-2-6-12(13)15(22)18-16-20-19-14(23-16)8-11-21-9-4-1-5-10-21/h2-3,6-7H,1,4-5,8-11H2,(H,18,20,22) |
| InChIKey | HJTFDKCUVSKTFT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.88 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |