About N,N-diethyl-4-methyl-1,1-dioxo-2H-thiet-3-amine
N,N-diethyl-4-methyl-1,1-dioxo-2H-thiet-3-amine (PubChem CID 12845635) has the molecular formula C8H15NO2S
and a molecular weight of 189.28 g/mol. Its IUPAC name is N,N-diethyl-4-methyl-1,1-dioxo-2H-thiet-3-amine.
Molecular Properties
| Compound Name | N,N-diethyl-4-methyl-1,1-dioxo-2H-thiet-3-amine |
| PubChem CID | 12845635 |
| Molecular Formula | C8H15NO2S |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | N,N-diethyl-4-methyl-1,1-dioxo-2H-thiet-3-amine |
| SMILES | CCN(CC)C1=C(C)S(=O)(=O)C1 |
| InChI | InChI=1S/C8H15NO2S/c1-4-9(5-2)8-6-12(10,11)7(8)3/h4-6H2,1-3H3 |
| InChIKey | MVAOQPUJTRACKO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diethyl-4-methyl-1,1-dioxo-2H-thiet-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-4-methyl-1,1-dioxo-2H-thiet-3-amine?
The IUPAC name of N,N-diethyl-4-methyl-1,1-dioxo-2H-thiet-3-amine (CID 12845635) is N,N-diethyl-4-methyl-1,1-dioxo-2H-thiet-3-amine.
What is the SMILES notation for N,N-diethyl-4-methyl-1,1-dioxo-2H-thiet-3-amine?
The canonical SMILES for N,N-diethyl-4-methyl-1,1-dioxo-2H-thiet-3-amine is CCN(CC)C1=C(C)S(=O)(=O)C1.
What is the InChIKey of N,N-diethyl-4-methyl-1,1-dioxo-2H-thiet-3-amine?
The InChIKey is MVAOQPUJTRACKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2S/c1-4-9(5-2)8-6-12(10,11)7(8)3/h4-6H2,1-3H3.
What are the key properties of N,N-diethyl-4-methyl-1,1-dioxo-2H-thiet-3-amine?
N,N-diethyl-4-methyl-1,1-dioxo-2H-thiet-3-amine has a molecular weight of 189.28 g/mol, XLogP of 0.99, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-4-methyl-1,1-dioxo-2H-thiet-3-amine is sourced from PubChem (CID 12845635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).