About 4-(4-methylphenyl)-2,6-diphenylpyrylium tetrafluoroborate
4-(4-methylphenyl)-2,6-diphenylpyrylium tetrafluoroborate (PubChem CID 12846137) has the molecular formula C24H19BF4O
and a molecular weight of 410.22 g/mol. Its IUPAC name is 4-(4-methylphenyl)-2,6-diphenylpyrylium tetrafluoroborate.
Molecular Properties
| Compound Name | 4-(4-methylphenyl)-2,6-diphenylpyrylium tetrafluoroborate |
| PubChem CID | 12846137 |
| Molecular Formula | C24H19BF4O |
| Molecular Weight | 410.22 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 4-(4-methylphenyl)-2,6-diphenylpyrylium tetrafluoroborate |
| SMILES | Cc1ccc(-c2cc(-c3ccccc3)[o+]c(-c3ccccc3)c2)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C24H19O.BF4/c1-18-12-14-19(15-13-18)22-16-23(20-8-4-2-5-9-20)25-24(17-22)21-10-6-3-7-11-21;2-1(3,4)5/h2-17H,1H3;/q+1;-1 |
| InChIKey | VDNHHTBRGIJSTG-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.22 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methylphenyl)-2,6-diphenylpyrylium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylphenyl)-2,6-diphenylpyrylium tetrafluoroborate?
The IUPAC name of 4-(4-methylphenyl)-2,6-diphenylpyrylium tetrafluoroborate (CID 12846137) is 4-(4-methylphenyl)-2,6-diphenylpyrylium tetrafluoroborate.
What is the SMILES notation for 4-(4-methylphenyl)-2,6-diphenylpyrylium tetrafluoroborate?
The canonical SMILES for 4-(4-methylphenyl)-2,6-diphenylpyrylium tetrafluoroborate is Cc1ccc(-c2cc(-c3ccccc3)[o+]c(-c3ccccc3)c2)cc1.F[B-](F)(F)F.
What is the InChIKey of 4-(4-methylphenyl)-2,6-diphenylpyrylium tetrafluoroborate?
The InChIKey is VDNHHTBRGIJSTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19O.BF4/c1-18-12-14-19(15-13-18)22-16-23(20-8-4-2-5-9-20)25-24(17-22)21-10-6-3-7-11-21;2-1(3,4)5/h2-17H,1H3;/q+1;-1.
What are the key properties of 4-(4-methylphenyl)-2,6-diphenylpyrylium tetrafluoroborate?
4-(4-methylphenyl)-2,6-diphenylpyrylium tetrafluoroborate has a molecular weight of 410.22 g/mol, XLogP of 8.17, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylphenyl)-2,6-diphenylpyrylium tetrafluoroborate is sourced from PubChem (CID 12846137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).