C19H28O8 — CID 12846320
diethyl 2-[(1S,4R)-4-(1,3-diethoxy-1,3-dioxopropan-2-yl)cyclopent-2-en-1-yl]propanedioate (PubChem CID 12846320) has the molecular formula C19H28O8 and a molecular weight of 384.43 g/mol. Its IUPAC name is diethyl 2-[(1S,4R)-4-(1,3-diethoxy-1,3-dioxopropan-2-yl)cyclopent-2-en-1-yl]propanedioate.
| Compound Name | diethyl 2-[(1S,4R)-4-(1,3-diethoxy-1,3-dioxopropan-2-yl)cyclopent-2-en-1-yl]propanedioate |
|---|---|
| PubChem CID | 12846320 |
| Molecular Formula | C19H28O8 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | diethyl 2-[(1S,4R)-4-(1,3-diethoxy-1,3-dioxopropan-2-yl)cyclopent-2-en-1-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H]1C=C[C@H](C(C(=O)OCC)C(=O)OCC)C1 |
| InChI | InChI=1S/C19H28O8/c1-5-24-16(20)14(17(21)25-6-2)12-9-10-13(11-12)15(18(22)26-7-3)19(23)27-8-4/h9-10,12-15H,5-8,11H2,1-4H3/t12-,13+ |
| InChIKey | FFZCPCAETOAFJA-BETUJISGSA-N |
| XLogP | 1.66 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|