C16H10ClN3O3 — CID 12846566
2-[4-(4-chlorobenzoyl)phenyl]-1,2,4-triazine-3,5-dione (PubChem CID 12846566) has the molecular formula C16H10ClN3O3 and a molecular weight of 327.73 g/mol. Its IUPAC name is 2-[4-(4-chlorobenzoyl)phenyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[4-(4-chlorobenzoyl)phenyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 12846566 |
| Molecular Formula | C16H10ClN3O3 |
| Molecular Weight | 327.73 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 2-[4-(4-chlorobenzoyl)phenyl]-1,2,4-triazine-3,5-dione |
| SMILES | O=C(c1ccc(Cl)cc1)c1ccc(-n2ncc(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C16H10ClN3O3/c17-12-5-1-10(2-6-12)15(22)11-3-7-13(8-4-11)20-16(23)19-14(21)9-18-20/h1-9H,(H,19,21,23) |
| InChIKey | YFCMCLDTQXKALJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.73 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |