C42H78N12O3 — CID 12846656
4,10,16,22,25,31-hexabutyl-7,19,28-trioxa-2,4,10,12,14,16,22,24,25,31,32,33-dodecazatetracyclo[11.11.7.13,23.111,15]tritriaconta-1(24),2,11,13,15(33),23(32)-hexaene (PubChem CID 12846656) has the molecular formula C42H78N12O3 and a molecular weight of 799.17 g/mol. Its IUPAC name is 4,10,16,22,25,31-hexabutyl-7,19,28-trioxa-2,4,10,12,14,16,22,24,25,31,32,33-dodecazatetracyclo[11.11.7.13,23.111,15]tritriaconta-1(24),2,11,13,15(33),23(32)-hexaene.
| Compound Name | 4,10,16,22,25,31-hexabutyl-7,19,28-trioxa-2,4,10,12,14,16,22,24,25,31,32,33-dodecazatetracyclo[11.11.7.13,23.111,15]tritriaconta-1(24),2,11,13,15(33),23(32)-hexaene |
|---|---|
| PubChem CID | 12846656 |
| Molecular Formula | C42H78N12O3 |
| Molecular Weight | 799.17 g/mol |
| Exact Mass | 798.63 |
| IUPAC Name | 4,10,16,22,25,31-hexabutyl-7,19,28-trioxa-2,4,10,12,14,16,22,24,25,31,32,33-dodecazatetracyclo[11.11.7.13,23.111,15]tritriaconta-1(24),2,11,13,15(33),23(32)-hexaene |
| SMILES | CCCCN1CCOCCN(CCCC)c2nc3nc(n2)N(CCCC)CCOCCN(CCCC)c2nc1nc(n2)N(CCCC)CCOCCN3CCCC |
| InChI | InChI=1S/C42H78N12O3/c1-7-13-19-49-25-31-55-32-26-52(22-16-10-4)40-46-41-48-42(47-40)54(24-18-12-6)30-36-57-34-28-51(21-15-9-3)39-44-37(49)43-38(45-39)50(20-14-8-2)27-33-56-35-29-53(41)23-17-11-5/h7-36H2,1-6H3 |
| InChIKey | BJHFASUDQICXEJ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 124.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.17 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|