About 2-(4-bromophenyl)-1,3-benzoxazole
2-(4-bromophenyl)-1,3-benzoxazole (PubChem CID 12846715) has the molecular formula C13H8BrNO
and a molecular weight of 274.12 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-1,3-benzoxazole |
| PubChem CID | 12846715 |
| Molecular Formula | C13H8BrNO |
| Molecular Weight | 274.12 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | 2-(4-bromophenyl)-1,3-benzoxazole |
| SMILES | Brc1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C13H8BrNO/c14-10-7-5-9(6-8-10)13-15-11-3-1-2-4-12(11)16-13/h1-8H |
| InChIKey | RBVHJNZMSBQFDK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.12 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-bromophenyl)-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-1,3-benzoxazole?
The IUPAC name of 2-(4-bromophenyl)-1,3-benzoxazole (CID 12846715) is 2-(4-bromophenyl)-1,3-benzoxazole.
What is the SMILES notation for 2-(4-bromophenyl)-1,3-benzoxazole?
The canonical SMILES for 2-(4-bromophenyl)-1,3-benzoxazole is Brc1ccc(-c2nc3ccccc3o2)cc1.
What is the InChIKey of 2-(4-bromophenyl)-1,3-benzoxazole?
The InChIKey is RBVHJNZMSBQFDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8BrNO/c14-10-7-5-9(6-8-10)13-15-11-3-1-2-4-12(11)16-13/h1-8H.
What are the key properties of 2-(4-bromophenyl)-1,3-benzoxazole?
2-(4-bromophenyl)-1,3-benzoxazole has a molecular weight of 274.12 g/mol, XLogP of 4.26, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-1,3-benzoxazole is sourced from PubChem (CID 12846715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).