C11H24OSi — CID 12846918
(Z,2R)-3-trimethylsilyloct-3-en-2-ol (PubChem CID 12846918) has the molecular formula C11H24OSi and a molecular weight of 200.40 g/mol. Its IUPAC name is (Z,2R)-3-trimethylsilyloct-3-en-2-ol.
| Compound Name | (Z,2R)-3-trimethylsilyloct-3-en-2-ol |
|---|---|
| PubChem CID | 12846918 |
| Molecular Formula | C11H24OSi |
| Molecular Weight | 200.40 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | (Z,2R)-3-trimethylsilyloct-3-en-2-ol |
| SMILES | CCCC/C=C(/[C@@H](C)O)[Si](C)(C)C |
| InChI | InChI=1S/C11H24OSi/c1-6-7-8-9-11(10(2)12)13(3,4)5/h9-10,12H,6-8H2,1-5H3/b11-9-/t10-/m1/s1 |
| InChIKey | KXUQSHZDEBBVMD-QLWWJYNRSA-N |
| XLogP | 3.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|