About cyclopenta-1,3-diene-1,2-dicarbonitrile
cyclopenta-1,3-diene-1,2-dicarbonitrile (PubChem CID 12846952) has the molecular formula C7H4N2
and a molecular weight of 116.12 g/mol. Its IUPAC name is cyclopenta-1,3-diene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene-1,2-dicarbonitrile |
| PubChem CID | 12846952 |
| Molecular Formula | C7H4N2 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.04 |
| IUPAC Name | cyclopenta-1,3-diene-1,2-dicarbonitrile |
| SMILES | N#CC1=C(C#N)CC=C1 |
| InChI | InChI=1S/C7H4N2/c8-4-6-2-1-3-7(6)5-9/h1-2H,3H2 |
| InChIKey | FAMRLSBVZVLPMA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopenta-1,3-diene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene-1,2-dicarbonitrile?
The IUPAC name of cyclopenta-1,3-diene-1,2-dicarbonitrile (CID 12846952) is cyclopenta-1,3-diene-1,2-dicarbonitrile.
What is the SMILES notation for cyclopenta-1,3-diene-1,2-dicarbonitrile?
The canonical SMILES for cyclopenta-1,3-diene-1,2-dicarbonitrile is N#CC1=C(C#N)CC=C1.
What is the InChIKey of cyclopenta-1,3-diene-1,2-dicarbonitrile?
The InChIKey is FAMRLSBVZVLPMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2/c8-4-6-2-1-3-7(6)5-9/h1-2H,3H2.
What are the key properties of cyclopenta-1,3-diene-1,2-dicarbonitrile?
cyclopenta-1,3-diene-1,2-dicarbonitrile has a molecular weight of 116.12 g/mol, XLogP of 1.29, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene-1,2-dicarbonitrile is sourced from PubChem (CID 12846952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).