About N-butyl-6-chloro-1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine
N-butyl-6-chloro-1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 12847866) has the molecular formula C15H15Cl2N5
and a molecular weight of 336.23 g/mol. Its IUPAC name is N-butyl-6-chloro-1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-butyl-6-chloro-1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 12847866 |
| Molecular Formula | C15H15Cl2N5 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | N-butyl-6-chloro-1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCCCNc1nc(Cl)nc2c1cnn2-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H15Cl2N5/c1-2-3-8-18-13-12-9-19-22(14(12)21-15(17)20-13)11-6-4-10(16)5-7-11/h4-7,9H,2-3,8H2,1H3,(H,18,20,21) |
| InChIKey | VXYFZGQNTIQZON-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-6-chloro-1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-6-chloro-1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of N-butyl-6-chloro-1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine (CID 12847866) is N-butyl-6-chloro-1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for N-butyl-6-chloro-1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for N-butyl-6-chloro-1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine is CCCCNc1nc(Cl)nc2c1cnn2-c1ccc(Cl)cc1.
What is the InChIKey of N-butyl-6-chloro-1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is VXYFZGQNTIQZON-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15Cl2N5/c1-2-3-8-18-13-12-9-19-22(14(12)21-15(17)20-13)11-6-4-10(16)5-7-11/h4-7,9H,2-3,8H2,1H3,(H,18,20,21).
What are the key properties of N-butyl-6-chloro-1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine?
N-butyl-6-chloro-1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 336.23 g/mol, XLogP of 4.33, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-6-chloro-1-(4-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 12847866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).