C5H9N3 — CID 12847948
1,4-dimethylpyrazol-5-amine (PubChem CID 12847948) has the molecular formula C5H9N3 and a molecular weight of 111.15 g/mol. Its IUPAC name is 1,4-dimethylpyrazol-5-amine.
| Compound Name | 1,4-dimethylpyrazol-5-amine |
|---|---|
| PubChem CID | 12847948 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | 1,4-dimethylpyrazol-5-amine |
| SMILES | Cc1cnn(C)c1N |
| InChI | InChI=1S/C5H9N3/c1-4-3-7-8(2)5(4)6/h3H,6H2,1-2H3 |
| InChIKey | AHTVCDZZGBELIK-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |