C26H22N2OS — CID 1284800
N-(1-methyl-4,5-dihydrobenzo[e][1,3]benzothiazol-2-ylidene)-2,2-diphenylacetamide (PubChem CID 1284800) has the molecular formula C26H22N2OS and a molecular weight of 410.54 g/mol. Its IUPAC name is N-(1-methyl-4,5-dihydrobenzo[e][1,3]benzothiazol-2-ylidene)-2,2-diphenylacetamide.
| Compound Name | N-(1-methyl-4,5-dihydrobenzo[e][1,3]benzothiazol-2-ylidene)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 1284800 |
| Molecular Formula | C26H22N2OS |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | N-(1-methyl-4,5-dihydrobenzo[e][1,3]benzothiazol-2-ylidene)-2,2-diphenylacetamide |
| SMILES | Cn1c2c(s/c1=N\C(=O)C(c1ccccc1)c1ccccc1)CCc1ccccc1-2 |
| InChI | InChI=1S/C26H22N2OS/c1-28-24-21-15-9-8-10-18(21)16-17-22(24)30-26(28)27-25(29)23(19-11-4-2-5-12-19)20-13-6-3-7-14-20/h2-15,23H,16-17H2,1H3/b27-26- |
| InChIKey | MKEQTGWIMXKSMF-RQZHXJHFSA-N |
| XLogP | 5.11 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|