C17H20N2O5 — CID 12848026
ethyl 8-(1-hydroxyethyl)-6,11-dioxo-5,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-6a-carboxylate (PubChem CID 12848026) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is ethyl 8-(1-hydroxyethyl)-6,11-dioxo-5,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-6a-carboxylate.
| Compound Name | ethyl 8-(1-hydroxyethyl)-6,11-dioxo-5,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-6a-carboxylate |
|---|---|
| PubChem CID | 12848026 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | ethyl 8-(1-hydroxyethyl)-6,11-dioxo-5,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-6a-carboxylate |
| SMILES | CCOC(=O)C12CC(C(C)O)CN1C(=O)c1ccccc1NC2=O |
| InChI | InChI=1S/C17H20N2O5/c1-3-24-16(23)17-8-11(10(2)20)9-19(17)14(21)12-6-4-5-7-13(12)18-15(17)22/h4-7,10-11,20H,3,8-9H2,1-2H3,(H,18,22) |
| InChIKey | IPNIBUXSZLWXJF-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|