About (2E)-4-hydroxy-3,7-dimethylocta-2,6-dienenitrile
(2E)-4-hydroxy-3,7-dimethylocta-2,6-dienenitrile (PubChem CID 12848404) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is (2E)-4-hydroxy-3,7-dimethylocta-2,6-dienenitrile.
Molecular Properties
| Compound Name | (2E)-4-hydroxy-3,7-dimethylocta-2,6-dienenitrile |
| PubChem CID | 12848404 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (2E)-4-hydroxy-3,7-dimethylocta-2,6-dienenitrile |
| SMILES | CC(C)=CCC(O)/C(C)=C/C#N |
| InChI | InChI=1S/C10H15NO/c1-8(2)4-5-10(12)9(3)6-7-11/h4,6,10,12H,5H2,1-3H3/b9-6+ |
| InChIKey | LCKNRRPKFTXLLY-RMKNXTFCSA-N |
| XLogP | 2.17 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-4-hydroxy-3,7-dimethylocta-2,6-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-4-hydroxy-3,7-dimethylocta-2,6-dienenitrile?
The IUPAC name of (2E)-4-hydroxy-3,7-dimethylocta-2,6-dienenitrile (CID 12848404) is (2E)-4-hydroxy-3,7-dimethylocta-2,6-dienenitrile.
What is the SMILES notation for (2E)-4-hydroxy-3,7-dimethylocta-2,6-dienenitrile?
The canonical SMILES for (2E)-4-hydroxy-3,7-dimethylocta-2,6-dienenitrile is CC(C)=CCC(O)/C(C)=C/C#N.
What is the InChIKey of (2E)-4-hydroxy-3,7-dimethylocta-2,6-dienenitrile?
The InChIKey is LCKNRRPKFTXLLY-RMKNXTFCSA-N. The full InChI is InChI=1S/C10H15NO/c1-8(2)4-5-10(12)9(3)6-7-11/h4,6,10,12H,5H2,1-3H3/b9-6+.
What are the key properties of (2E)-4-hydroxy-3,7-dimethylocta-2,6-dienenitrile?
(2E)-4-hydroxy-3,7-dimethylocta-2,6-dienenitrile has a molecular weight of 165.24 g/mol, XLogP of 2.17, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-4-hydroxy-3,7-dimethylocta-2,6-dienenitrile is sourced from PubChem (CID 12848404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).