About (6-methylcyclohexen-1-yl) prop-2-enyl carbonate
(6-methylcyclohexen-1-yl) prop-2-enyl carbonate (PubChem CID 12848611) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is (6-methylcyclohexen-1-yl) prop-2-enyl carbonate.
Molecular Properties
| Compound Name | (6-methylcyclohexen-1-yl) prop-2-enyl carbonate |
| PubChem CID | 12848611 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (6-methylcyclohexen-1-yl) prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)OC1=CCCCC1C |
| InChI | InChI=1S/C11H16O3/c1-3-8-13-11(12)14-10-7-5-4-6-9(10)2/h3,7,9H,1,4-6,8H2,2H3 |
| InChIKey | NXSXBDOPGALRJE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6-methylcyclohexen-1-yl) prop-2-enyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methylcyclohexen-1-yl) prop-2-enyl carbonate?
The IUPAC name of (6-methylcyclohexen-1-yl) prop-2-enyl carbonate (CID 12848611) is (6-methylcyclohexen-1-yl) prop-2-enyl carbonate.
What is the SMILES notation for (6-methylcyclohexen-1-yl) prop-2-enyl carbonate?
The canonical SMILES for (6-methylcyclohexen-1-yl) prop-2-enyl carbonate is C=CCOC(=O)OC1=CCCCC1C.
What is the InChIKey of (6-methylcyclohexen-1-yl) prop-2-enyl carbonate?
The InChIKey is NXSXBDOPGALRJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-3-8-13-11(12)14-10-7-5-4-6-9(10)2/h3,7,9H,1,4-6,8H2,2H3.
What are the key properties of (6-methylcyclohexen-1-yl) prop-2-enyl carbonate?
(6-methylcyclohexen-1-yl) prop-2-enyl carbonate has a molecular weight of 196.25 g/mol, XLogP of 3.03, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methylcyclohexen-1-yl) prop-2-enyl carbonate is sourced from PubChem (CID 12848611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).