About 1-methyl-1,2,3,3-tetra(propan-2-yl)guanidine
1-methyl-1,2,3,3-tetra(propan-2-yl)guanidine (PubChem CID 12848651) has the molecular formula C14H31N3
and a molecular weight of 241.42 g/mol. Its IUPAC name is 1-methyl-1,2,3,3-tetra(propan-2-yl)guanidine.
Molecular Properties
| Compound Name | 1-methyl-1,2,3,3-tetra(propan-2-yl)guanidine |
| PubChem CID | 12848651 |
| Molecular Formula | C14H31N3 |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.25 |
| IUPAC Name | 1-methyl-1,2,3,3-tetra(propan-2-yl)guanidine |
| SMILES | CC(C)/N=C(\N(C)C(C)C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C14H31N3/c1-10(2)15-14(16(9)11(3)4)17(12(5)6)13(7)8/h10-13H,1-9H3/b15-14+ |
| InChIKey | SNMBMWSDHVLDOY-CCEZHUSRSA-N |
| XLogP | 3.21 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-1,2,3,3-tetra(propan-2-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1,2,3,3-tetra(propan-2-yl)guanidine?
The IUPAC name of 1-methyl-1,2,3,3-tetra(propan-2-yl)guanidine (CID 12848651) is 1-methyl-1,2,3,3-tetra(propan-2-yl)guanidine.
What is the SMILES notation for 1-methyl-1,2,3,3-tetra(propan-2-yl)guanidine?
The canonical SMILES for 1-methyl-1,2,3,3-tetra(propan-2-yl)guanidine is CC(C)/N=C(\N(C)C(C)C)N(C(C)C)C(C)C.
What is the InChIKey of 1-methyl-1,2,3,3-tetra(propan-2-yl)guanidine?
The InChIKey is SNMBMWSDHVLDOY-CCEZHUSRSA-N. The full InChI is InChI=1S/C14H31N3/c1-10(2)15-14(16(9)11(3)4)17(12(5)6)13(7)8/h10-13H,1-9H3/b15-14+.
What are the key properties of 1-methyl-1,2,3,3-tetra(propan-2-yl)guanidine?
1-methyl-1,2,3,3-tetra(propan-2-yl)guanidine has a molecular weight of 241.42 g/mol, XLogP of 3.21, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1,2,3,3-tetra(propan-2-yl)guanidine is sourced from PubChem (CID 12848651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).