C13H29N3 — CID 12848653
1,1,2,3-tetra(propan-2-yl)guanidine (PubChem CID 12848653) has the molecular formula C13H29N3 and a molecular weight of 227.40 g/mol. Its IUPAC name is 1,1,2,3-tetra(propan-2-yl)guanidine.
| Compound Name | 1,1,2,3-tetra(propan-2-yl)guanidine |
|---|---|
| PubChem CID | 12848653 |
| Molecular Formula | C13H29N3 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.24 |
| IUPAC Name | 1,1,2,3-tetra(propan-2-yl)guanidine |
| SMILES | CC(C)/N=C(\NC(C)C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C13H29N3/c1-9(2)14-13(15-10(3)4)16(11(5)6)12(7)8/h9-12H,1-8H3,(H,14,15) |
| InChIKey | VGVRSKXHDYRWHE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|