C19H26N6O — CID 12849111
1-cyano-2-methyl-3-[5-[3-(4-methylphenyl)-6-oxo-4,5-dihydropyridazin-1-yl]pentyl]guanidine (PubChem CID 12849111) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is 1-cyano-2-methyl-3-[5-[3-(4-methylphenyl)-6-oxo-4,5-dihydropyridazin-1-yl]pentyl]guanidine.
| Compound Name | 1-cyano-2-methyl-3-[5-[3-(4-methylphenyl)-6-oxo-4,5-dihydropyridazin-1-yl]pentyl]guanidine |
|---|---|
| PubChem CID | 12849111 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 1-cyano-2-methyl-3-[5-[3-(4-methylphenyl)-6-oxo-4,5-dihydropyridazin-1-yl]pentyl]guanidine |
| SMILES | C/N=C(\NC#N)NCCCCCN1N=C(c2ccc(C)cc2)CCC1=O |
| InChI | InChI=1S/C19H26N6O/c1-15-6-8-16(9-7-15)17-10-11-18(26)25(24-17)13-5-3-4-12-22-19(21-2)23-14-20/h6-9H,3-5,10-13H2,1-2H3,(H2,21,22,23) |
| InChIKey | MXKIZVKAFIJKPZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 92.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|