About 2-butoxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one
2-butoxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one (PubChem CID 12849129) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is 2-butoxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one.
Molecular Properties
| Compound Name | 2-butoxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one |
| PubChem CID | 12849129 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 2-butoxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one |
| SMILES | CCCCOC1CC2=C(CCCC2=O)O1 |
| InChI | InChI=1S/C12H18O3/c1-2-3-7-14-12-8-9-10(13)5-4-6-11(9)15-12/h12H,2-8H2,1H3 |
| InChIKey | LBHQHBYHHOLBTC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one?
The IUPAC name of 2-butoxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one (CID 12849129) is 2-butoxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one.
What is the SMILES notation for 2-butoxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one?
The canonical SMILES for 2-butoxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one is CCCCOC1CC2=C(CCCC2=O)O1.
What is the InChIKey of 2-butoxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one?
The InChIKey is LBHQHBYHHOLBTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3/c1-2-3-7-14-12-8-9-10(13)5-4-6-11(9)15-12/h12H,2-8H2,1H3.
What are the key properties of 2-butoxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one?
2-butoxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one has a molecular weight of 210.27 g/mol, XLogP of 2.56, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxy-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one is sourced from PubChem (CID 12849129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).