C18H21N5O — CID 12849783
5-[(8-methoxy-7-propylquinolin-5-yl)methyl]pyrimidine-2,4-diamine (PubChem CID 12849783) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 5-[(8-methoxy-7-propylquinolin-5-yl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[(8-methoxy-7-propylquinolin-5-yl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 12849783 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 5-[(8-methoxy-7-propylquinolin-5-yl)methyl]pyrimidine-2,4-diamine |
| SMILES | CCCc1cc(Cc2cnc(N)nc2N)c2cccnc2c1OC |
| InChI | InChI=1S/C18H21N5O/c1-3-5-11-8-12(9-13-10-22-18(20)23-17(13)19)14-6-4-7-21-15(14)16(11)24-2/h4,6-8,10H,3,5,9H2,1-2H3,(H4,19,20,22,23) |
| InChIKey | NFEVMZZGTJFTLX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |