C14H17N — CID 12850461
(4aS,10bR)-8-methyl-1,2,3,4,4a,10b-hexahydrobenzo[f]isoquinoline (PubChem CID 12850461) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is (4aS,10bR)-8-methyl-1,2,3,4,4a,10b-hexahydrobenzo[f]isoquinoline.
| Compound Name | (4aS,10bR)-8-methyl-1,2,3,4,4a,10b-hexahydrobenzo[f]isoquinoline |
|---|---|
| PubChem CID | 12850461 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | (4aS,10bR)-8-methyl-1,2,3,4,4a,10b-hexahydrobenzo[f]isoquinoline |
| SMILES | Cc1ccc2c(c1)C=C[C@@H]1CNCC[C@@H]21 |
| InChI | InChI=1S/C14H17N/c1-10-2-5-13-11(8-10)3-4-12-9-15-7-6-14(12)13/h2-5,8,12,14-15H,6-7,9H2,1H3/t12-,14-/m1/s1 |
| InChIKey | LCWBMHZRKVEFLF-TZMCWYRMSA-N |
| XLogP | 2.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |