C10H12FNS — CID 12850662
8-fluoro-2,3,4,6-tetrahydro-1H-5,1-benzothiazocine (PubChem CID 12850662) has the molecular formula C10H12FNS and a molecular weight of 197.28 g/mol. Its IUPAC name is 8-fluoro-2,3,4,6-tetrahydro-1H-5,1-benzothiazocine.
| Compound Name | 8-fluoro-2,3,4,6-tetrahydro-1H-5,1-benzothiazocine |
|---|---|
| PubChem CID | 12850662 |
| Molecular Formula | C10H12FNS |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 8-fluoro-2,3,4,6-tetrahydro-1H-5,1-benzothiazocine |
| SMILES | Fc1ccc2c(c1)CSCCCN2 |
| InChI | InChI=1S/C10H12FNS/c11-9-2-3-10-8(6-9)7-13-5-1-4-12-10/h2-3,6,12H,1,4-5,7H2 |
| InChIKey | OJLZCHGFHNTFIH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |