About 5-pyridin-4-yl-1,3-dihydrobenzimidazol-2-one
5-pyridin-4-yl-1,3-dihydrobenzimidazol-2-one (PubChem CID 12850742) has the molecular formula C12H9N3O
and a molecular weight of 211.22 g/mol. Its IUPAC name is 5-pyridin-4-yl-1,3-dihydrobenzimidazol-2-one.
Molecular Properties
| Compound Name | 5-pyridin-4-yl-1,3-dihydrobenzimidazol-2-one |
| PubChem CID | 12850742 |
| Molecular Formula | C12H9N3O |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 5-pyridin-4-yl-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2ccc(-c3ccncc3)cc2[nH]1 |
| InChI | InChI=1S/C12H9N3O/c16-12-14-10-2-1-9(7-11(10)15-12)8-3-5-13-6-4-8/h1-7H,(H2,14,15,16) |
| InChIKey | GEEVQMQSWBDLIT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-pyridin-4-yl-1,3-dihydrobenzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyridin-4-yl-1,3-dihydrobenzimidazol-2-one?
The IUPAC name of 5-pyridin-4-yl-1,3-dihydrobenzimidazol-2-one (CID 12850742) is 5-pyridin-4-yl-1,3-dihydrobenzimidazol-2-one.
What is the SMILES notation for 5-pyridin-4-yl-1,3-dihydrobenzimidazol-2-one?
The canonical SMILES for 5-pyridin-4-yl-1,3-dihydrobenzimidazol-2-one is O=c1[nH]c2ccc(-c3ccncc3)cc2[nH]1.
What is the InChIKey of 5-pyridin-4-yl-1,3-dihydrobenzimidazol-2-one?
The InChIKey is GEEVQMQSWBDLIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O/c16-12-14-10-2-1-9(7-11(10)15-12)8-3-5-13-6-4-8/h1-7H,(H2,14,15,16).
What are the key properties of 5-pyridin-4-yl-1,3-dihydrobenzimidazol-2-one?
5-pyridin-4-yl-1,3-dihydrobenzimidazol-2-one has a molecular weight of 211.22 g/mol, XLogP of 1.92, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyridin-4-yl-1,3-dihydrobenzimidazol-2-one is sourced from PubChem (CID 12850742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).