C18H21Cl2N5OS — CID 12850845
methyl N-cyano-N'-[5-[3-(3,4-dichlorophenyl)-6-oxo-4,5-dihydropyridazin-1-yl]pentyl]carbamimidothioate (PubChem CID 12850845) has the molecular formula C18H21Cl2N5OS and a molecular weight of 426.37 g/mol. Its IUPAC name is methyl N-cyano-N'-[5-[3-(3,4-dichlorophenyl)-6-oxo-4,5-dihydropyridazin-1-yl]pentyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[5-[3-(3,4-dichlorophenyl)-6-oxo-4,5-dihydropyridazin-1-yl]pentyl]carbamimidothioate |
|---|---|
| PubChem CID | 12850845 |
| Molecular Formula | C18H21Cl2N5OS |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | methyl N-cyano-N'-[5-[3-(3,4-dichlorophenyl)-6-oxo-4,5-dihydropyridazin-1-yl]pentyl]carbamimidothioate |
| SMILES | CS/C(=N\CCCCCN1N=C(c2ccc(Cl)c(Cl)c2)CCC1=O)NC#N |
| InChI | InChI=1S/C18H21Cl2N5OS/c1-27-18(23-12-21)22-9-3-2-4-10-25-17(26)8-7-16(24-25)13-5-6-14(19)15(20)11-13/h5-6,11H,2-4,7-10H2,1H3,(H,22,23) |
| InChIKey | IOICPGXNWFKSHY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|