C20H27N5O4S — CID 12850848
methyl N-cyano-N'-[4-[6-oxo-3-(3,4,5-trimethoxyphenyl)-4,5-dihydropyridazin-1-yl]butyl]carbamimidothioate (PubChem CID 12850848) has the molecular formula C20H27N5O4S and a molecular weight of 433.53 g/mol. Its IUPAC name is methyl N-cyano-N'-[4-[6-oxo-3-(3,4,5-trimethoxyphenyl)-4,5-dihydropyridazin-1-yl]butyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[4-[6-oxo-3-(3,4,5-trimethoxyphenyl)-4,5-dihydropyridazin-1-yl]butyl]carbamimidothioate |
|---|---|
| PubChem CID | 12850848 |
| Molecular Formula | C20H27N5O4S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | methyl N-cyano-N'-[4-[6-oxo-3-(3,4,5-trimethoxyphenyl)-4,5-dihydropyridazin-1-yl]butyl]carbamimidothioate |
| SMILES | COc1cc(C2=NN(CCCC/N=C(/NC#N)SC)C(=O)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C20H27N5O4S/c1-27-16-11-14(12-17(28-2)19(16)29-3)15-7-8-18(26)25(24-15)10-6-5-9-22-20(30-4)23-13-21/h11-12H,5-10H2,1-4H3,(H,22,23) |
| InChIKey | QDMTVQQIZHRUNH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 108.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|