C12H21NO2S — CID 128512397
1-cyclopropylsulfonyl-3,3-dimethyl-2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole (PubChem CID 128512397) has the molecular formula C12H21NO2S and a molecular weight of 243.37 g/mol. Its IUPAC name is 1-cyclopropylsulfonyl-3,3-dimethyl-2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole.
| Compound Name | 1-cyclopropylsulfonyl-3,3-dimethyl-2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole |
|---|---|
| PubChem CID | 128512397 |
| Molecular Formula | C12H21NO2S |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 1-cyclopropylsulfonyl-3,3-dimethyl-2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole |
| SMILES | CC1(C)CN(S(=O)(=O)C2CC2)C2CCCC21 |
| InChI | InChI=1S/C12H21NO2S/c1-12(2)8-13(11-5-3-4-10(11)12)16(14,15)9-6-7-9/h9-11H,3-8H2,1-2H3 |
| InChIKey | FHSKGCIHIWUGLN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |