About 5-pyridin-4-yl-3H-1,3-benzoxazol-2-one
5-pyridin-4-yl-3H-1,3-benzoxazol-2-one (PubChem CID 12851329) has the molecular formula C12H8N2O2
and a molecular weight of 212.21 g/mol. Its IUPAC name is 5-pyridin-4-yl-3H-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 5-pyridin-4-yl-3H-1,3-benzoxazol-2-one |
| PubChem CID | 12851329 |
| Molecular Formula | C12H8N2O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 5-pyridin-4-yl-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2cc(-c3ccncc3)ccc2o1 |
| InChI | InChI=1S/C12H8N2O2/c15-12-14-10-7-9(1-2-11(10)16-12)8-3-5-13-6-4-8/h1-7H,(H,14,15) |
| InChIKey | SCOBJAZLXMUADS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-pyridin-4-yl-3H-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyridin-4-yl-3H-1,3-benzoxazol-2-one?
The IUPAC name of 5-pyridin-4-yl-3H-1,3-benzoxazol-2-one (CID 12851329) is 5-pyridin-4-yl-3H-1,3-benzoxazol-2-one.
What is the SMILES notation for 5-pyridin-4-yl-3H-1,3-benzoxazol-2-one?
The canonical SMILES for 5-pyridin-4-yl-3H-1,3-benzoxazol-2-one is O=c1[nH]c2cc(-c3ccncc3)ccc2o1.
What is the InChIKey of 5-pyridin-4-yl-3H-1,3-benzoxazol-2-one?
The InChIKey is SCOBJAZLXMUADS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O2/c15-12-14-10-7-9(1-2-11(10)16-12)8-3-5-13-6-4-8/h1-7H,(H,14,15).
What are the key properties of 5-pyridin-4-yl-3H-1,3-benzoxazol-2-one?
5-pyridin-4-yl-3H-1,3-benzoxazol-2-one has a molecular weight of 212.21 g/mol, XLogP of 2.18, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyridin-4-yl-3H-1,3-benzoxazol-2-one is sourced from PubChem (CID 12851329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).